C24H28N2O7 — CID 163225234
2-[4-[3-[3-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]oxyphenyl]phenoxy]butanoylamino]acetic acid (PubChem CID 163225234) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[4-[3-[3-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]oxyphenyl]phenoxy]butanoylamino]acetic acid.
| Compound Name | 2-[4-[3-[3-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]oxyphenyl]phenoxy]butanoylamino]acetic acid |
|---|---|
| PubChem CID | 163225234 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-[4-[3-[3-[(3R,5S)-5-methoxycarbonylpyrrolidin-3-yl]oxyphenyl]phenoxy]butanoylamino]acetic acid |
| SMILES | COC(=O)[C@@H]1C[C@@H](Oc2cccc(-c3cccc(OCCCC(=O)NCC(=O)O)c3)c2)CN1 |
| InChI | InChI=1S/C24H28N2O7/c1-31-24(30)21-13-20(14-25-21)33-19-8-3-6-17(12-19)16-5-2-7-18(11-16)32-10-4-9-22(27)26-15-23(28)29/h2-3,5-8,11-12,20-21,25H,4,9-10,13-15H2,1H3,(H,26,27)(H,28,29)/t20-,21+/m1/s1 |
| InChIKey | RLDKCQONOAEVCJ-RTWAWAEBSA-N |
| XLogP | 2.00 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|