C18H22F3NO7S — CID 163225667
1-O-tert-butyl 2-O-methyl (2S,4S)-4-[4-(trifluoromethyl)phenyl]sulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 163225667) has the molecular formula C18H22F3NO7S and a molecular weight of 453.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[4-(trifluoromethyl)phenyl]sulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[4-(trifluoromethyl)phenyl]sulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163225667 |
| Molecular Formula | C18H22F3NO7S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[4-(trifluoromethyl)phenyl]sulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22F3NO7S/c1-17(2,3)28-16(24)22-10-12(9-14(22)15(23)27-4)29-30(25,26)13-7-5-11(6-8-13)18(19,20)21/h5-8,12,14H,9-10H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | QEUMAIHVDABPDM-JSGCOSHPSA-N |
| XLogP | 2.96 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|