C29H32FN5O4S — CID 163226424
(2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(4-fluorophenyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide (PubChem CID 163226424) has the molecular formula C29H32FN5O4S and a molecular weight of 565.67 g/mol. Its IUPAC name is (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(4-fluorophenyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(4-fluorophenyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163226424 |
| Molecular Formula | C29H32FN5O4S |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(4-fluorophenyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2C[C@H](c3ccc(F)cc3)CN2C(=O)CNC(=O)CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C29H32FN5O4S/c30-22-10-8-19(9-11-22)20-14-25(29(38)34-15-24-13-21(18-40-24)28(31)32)35(17-20)27(37)16-33-26(36)7-4-12-39-23-5-2-1-3-6-23/h1-3,5-6,8-11,13,18,20,25H,4,7,12,14-17H2,(H3,31,32)(H,33,36)(H,34,38)/t20-,25-/m0/s1 |
| InChIKey | UVTBODABHJGGQL-CPJSRVTESA-N |
| XLogP | 3.15 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|