C30H35FN4O4 — CID 163227214
8-[2-fluoro-6-(3-methoxybutyl)phenyl]-7-methyl-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 163227214) has the molecular formula C30H35FN4O4 and a molecular weight of 534.63 g/mol. Its IUPAC name is 8-[2-fluoro-6-(3-methoxybutyl)phenyl]-7-methyl-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 8-[2-fluoro-6-(3-methoxybutyl)phenyl]-7-methyl-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 163227214 |
| Molecular Formula | C30H35FN4O4 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 8-[2-fluoro-6-(3-methoxybutyl)phenyl]-7-methyl-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5c(F)cccc5CCC(C)OC)c(C)cc24)OCC3)C(C)C1 |
| InChI | InChI=1S/C30H35FN4O4/c1-6-24(36)33-12-13-34(19(3)17-33)29-22-16-18(2)25(28-27(22)35(14-15-39-28)30(37)32-29)26-21(8-7-9-23(26)31)11-10-20(4)38-5/h6-9,16,19-20H,1,10-15,17H2,2-5H3 |
| InChIKey | UUDLSOAJPDPQBS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|