C19H20Cl2N4O2 — CID 163227269
1-[(1R)-6,7-dichloro-1-methyl-9-(1-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-methoxyethanone (PubChem CID 163227269) has the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.30 g/mol. Its IUPAC name is 1-[(1R)-6,7-dichloro-1-methyl-9-(1-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-methoxyethanone.
| Compound Name | 1-[(1R)-6,7-dichloro-1-methyl-9-(1-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 163227269 |
| Molecular Formula | C19H20Cl2N4O2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[(1R)-6,7-dichloro-1-methyl-9-(1-methylpyrazol-3-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCc2[nH]c3c(Cl)c(Cl)cc(-c4ccn(C)n4)c3c2[C@H]1C |
| InChI | InChI=1S/C19H20Cl2N4O2/c1-10-16-14(5-7-25(10)15(26)9-27-3)22-19-17(16)11(8-12(20)18(19)21)13-4-6-24(2)23-13/h4,6,8,10,22H,5,7,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | LGTQBCOTTRYYMF-SNVBAGLBSA-N |
| XLogP | 3.97 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |