C20H19ClN6O2 — CID 163227858
N-[5-(1H-benzimidazol-2-yl)-1H-pyrazol-3-yl]-3-chloro-4-(2-methoxyethylamino)benzamide (PubChem CID 163227858) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is N-[5-(1H-benzimidazol-2-yl)-1H-pyrazol-3-yl]-3-chloro-4-(2-methoxyethylamino)benzamide.
| Compound Name | N-[5-(1H-benzimidazol-2-yl)-1H-pyrazol-3-yl]-3-chloro-4-(2-methoxyethylamino)benzamide |
|---|---|
| PubChem CID | 163227858 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[5-(1H-benzimidazol-2-yl)-1H-pyrazol-3-yl]-3-chloro-4-(2-methoxyethylamino)benzamide |
| SMILES | COCCNc1ccc(C(=O)Nc2cc(-c3nc4ccccc4[nH]3)[nH]n2)cc1Cl |
| InChI | InChI=1S/C20H19ClN6O2/c1-29-9-8-22-14-7-6-12(10-13(14)21)20(28)25-18-11-17(26-27-18)19-23-15-4-2-3-5-16(15)24-19/h2-7,10-11,22H,8-9H2,1H3,(H,23,24)(H2,25,26,27,28) |
| InChIKey | WVIIGYRQQSLLJP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|