C28H36F3N3O — CID 163228896
cyclohexane;4-(4-ethylphenyl)butanamide;2-(trifluoromethyl)quinolin-4-amine (PubChem CID 163228896) has the molecular formula C28H36F3N3O and a molecular weight of 487.61 g/mol. Its IUPAC name is cyclohexane;4-(4-ethylphenyl)butanamide;2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | cyclohexane;4-(4-ethylphenyl)butanamide;2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 163228896 |
| Molecular Formula | C28H36F3N3O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | cyclohexane;4-(4-ethylphenyl)butanamide;2-(trifluoromethyl)quinolin-4-amine |
| SMILES | C1CCCCC1.CCc1ccc(CCCC(N)=O)cc1.Nc1cc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H17NO.C10H7F3N2.C6H12/c1-2-10-6-8-11(9-7-10)4-3-5-12(13)14;11-10(12,13)9-5-7(14)6-3-1-2-4-8(6)15-9;1-2-4-6-5-3-1/h6-9H,2-5H2,1H3,(H2,13,14);1-5H,(H2,14,15);1-6H2 |
| InChIKey | IYJIZBCLWZUPHB-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |