C26H28ClF3N5O- — CID 163228911
N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-ethyl-4,5,6,7-tetrahydroindazole-3-carboximidate (PubChem CID 163228911) has the molecular formula C26H28ClF3N5O- and a molecular weight of 518.99 g/mol. Its IUPAC name is N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-ethyl-4,5,6,7-tetrahydroindazole-3-carboximidate.
| Compound Name | N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-ethyl-4,5,6,7-tetrahydroindazole-3-carboximidate |
|---|---|
| PubChem CID | 163228911 |
| Molecular Formula | C26H28ClF3N5O- |
| Molecular Weight | 518.99 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-ethyl-4,5,6,7-tetrahydroindazole-3-carboximidate |
| SMILES | CCn1nc2c(c1/C([O-])=N/C1CCC[C@H](Nc3cc(C(F)(F)F)nc4ccc(Cl)cc34)C1)CCCC2 |
| InChI | InChI=1S/C26H29ClF3N5O/c1-2-35-24(18-8-3-4-9-21(18)34-35)25(36)32-17-7-5-6-16(13-17)31-22-14-23(26(28,29)30)33-20-11-10-15(27)12-19(20)22/h10-12,14,16-17H,2-9,13H2,1H3,(H,31,33)(H,32,36)/p-1/t16-,17?/m0/s1 |
| InChIKey | IKJXHHKTOUEGCB-BHWOMJMDSA-M |
| XLogP | 5.53 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.99 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|