C24H21ClF3N4NiO- — CID 163228923
N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide;nickel (PubChem CID 163228923) has the molecular formula C24H21ClF3N4NiO- and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide;nickel.
| Compound Name | N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide;nickel |
|---|---|
| PubChem CID | 163228923 |
| Molecular Formula | C24H21ClF3N4NiO- |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide;nickel |
| SMILES | [H]/N=C(/C(=O)N[C@@H]1CCC[C@H](Nc2cc(C(F)(F)F)nc3ccc(Cl)cc23)C1)c1[c-]cccc1.[Ni] |
| InChI | InChI=1S/C24H21ClF3N4O.Ni/c25-15-9-10-19-18(11-15)20(13-21(32-19)24(26,27)28)30-16-7-4-8-17(12-16)31-23(33)22(29)14-5-2-1-3-6-14;/h1-3,5,9-11,13,16-17,29H,4,7-8,12H2,(H,30,32)(H,31,33);/q-1;/b29-22+;/t16-,17+;/m0./s1 |
| InChIKey | HGXCLESYQZEFFQ-SBLOGSCLSA-N |
| XLogP | 5.61 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|