About 3-ethenyl-2-ethyl-3,4-dihydropyrazole
3-ethenyl-2-ethyl-3,4-dihydropyrazole (PubChem CID 163229565) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3-ethenyl-2-ethyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 3-ethenyl-2-ethyl-3,4-dihydropyrazole |
| PubChem CID | 163229565 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3-ethenyl-2-ethyl-3,4-dihydropyrazole |
| SMILES | C=CC1CC=NN1CC |
| InChI | InChI=1S/C7H12N2/c1-3-7-5-6-8-9(7)4-2/h3,6-7H,1,4-5H2,2H3 |
| InChIKey | YPAOBFSVPGDUKE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2-ethyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-ethyl-3,4-dihydropyrazole?
The IUPAC name of 3-ethenyl-2-ethyl-3,4-dihydropyrazole (CID 163229565) is 3-ethenyl-2-ethyl-3,4-dihydropyrazole.
What is the SMILES notation for 3-ethenyl-2-ethyl-3,4-dihydropyrazole?
The canonical SMILES for 3-ethenyl-2-ethyl-3,4-dihydropyrazole is C=CC1CC=NN1CC.
What is the InChIKey of 3-ethenyl-2-ethyl-3,4-dihydropyrazole?
The InChIKey is YPAOBFSVPGDUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-7-5-6-8-9(7)4-2/h3,6-7H,1,4-5H2,2H3.
What are the key properties of 3-ethenyl-2-ethyl-3,4-dihydropyrazole?
3-ethenyl-2-ethyl-3,4-dihydropyrazole has a molecular weight of 124.19 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-ethyl-3,4-dihydropyrazole is sourced from PubChem (CID 163229565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).