C11H21NO — CID 163229690
ethane;(3E)-2-methoxy-N,5-dimethylhexa-1,3,5-trien-3-amine (PubChem CID 163229690) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;(3E)-2-methoxy-N,5-dimethylhexa-1,3,5-trien-3-amine.
| Compound Name | ethane;(3E)-2-methoxy-N,5-dimethylhexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 163229690 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;(3E)-2-methoxy-N,5-dimethylhexa-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C=C(/NC)C(=C)OC.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-7(2)6-9(10-4)8(3)11-5;1-2/h6,10H,1,3H2,2,4-5H3;1-2H3/b9-6+; |
| InChIKey | XKQYCWMKYXATJW-MLBSPLJJSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|