C13H16FN3O3 — CID 163230417
ethane;1-[(E)-(3-fluoro-2-hydroxy-5-methylphenyl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 163230417) has the molecular formula C13H16FN3O3 and a molecular weight of 281.29 g/mol. Its IUPAC name is ethane;1-[(E)-(3-fluoro-2-hydroxy-5-methylphenyl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | ethane;1-[(E)-(3-fluoro-2-hydroxy-5-methylphenyl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163230417 |
| Molecular Formula | C13H16FN3O3 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethane;1-[(E)-(3-fluoro-2-hydroxy-5-methylphenyl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | CC.Cc1cc(F)c(O)c(/C=N/N2CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H10FN3O3.C2H6/c1-6-2-7(10(17)8(12)3-6)4-13-15-5-9(16)14-11(15)18;1-2/h2-4,17H,5H2,1H3,(H,14,16,18);1-2H3/b13-4+; |
| InChIKey | GRNLRBRMRQJCTH-GAYQJXMFSA-N |
| XLogP | 1.75 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|