C38H74O7 — CID 163230542
(2,3-dihydroxy-3-octylundecanoyl) 2,3-dihydroxy-3-octylundecanoate (PubChem CID 163230542) has the molecular formula C38H74O7 and a molecular weight of 643.00 g/mol. Its IUPAC name is (2,3-dihydroxy-3-octylundecanoyl) 2,3-dihydroxy-3-octylundecanoate.
| Compound Name | (2,3-dihydroxy-3-octylundecanoyl) 2,3-dihydroxy-3-octylundecanoate |
|---|---|
| PubChem CID | 163230542 |
| Molecular Formula | C38H74O7 |
| Molecular Weight | 643.00 g/mol |
| Exact Mass | 642.54 |
| IUPAC Name | (2,3-dihydroxy-3-octylundecanoyl) 2,3-dihydroxy-3-octylundecanoate |
| SMILES | CCCCCCCCC(O)(CCCCCCCC)C(O)C(=O)OC(=O)C(O)C(O)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C38H74O7/c1-5-9-13-17-21-25-29-37(43,30-26-22-18-14-10-6-2)33(39)35(41)45-36(42)34(40)38(44,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4/h33-34,39-40,43-44H,5-32H2,1-4H3 |
| InChIKey | HYTVFVDYOOHZHQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.00 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|