C26H34N6O2 — CID 163231026
4-[2-[3-(dimethylamino)propoxy]-4-piperazin-1-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 163231026) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 4-[2-[3-(dimethylamino)propoxy]-4-piperazin-1-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[2-[3-(dimethylamino)propoxy]-4-piperazin-1-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 163231026 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 4-[2-[3-(dimethylamino)propoxy]-4-piperazin-1-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | CN(C)CCCOc1nc2c(c(N3CCNCC3)n1)CCN(c1cc(O)cc3ccccc13)C2 |
| InChI | InChI=1S/C26H34N6O2/c1-30(2)11-5-15-34-26-28-23-18-32(24-17-20(33)16-19-6-3-4-7-21(19)24)12-8-22(23)25(29-26)31-13-9-27-10-14-31/h3-4,6-7,16-17,27,33H,5,8-15,18H2,1-2H3 |
| InChIKey | GUUJDERFSRTYAD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|