C12H13N3O2 — CID 163231111
1-(2,3-dihydro-1H-indol-6-yl)-1,3-diazinane-2,4-dione (PubChem CID 163231111) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-6-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2,3-dihydro-1H-indol-6-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 163231111 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-6-yl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc3c(c2)NCC3)C(=O)N1 |
| InChI | InChI=1S/C12H13N3O2/c16-11-4-6-15(12(17)14-11)9-2-1-8-3-5-13-10(8)7-9/h1-2,7,13H,3-6H2,(H,14,16,17) |
| InChIKey | OZCCTUAQZRVOCI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |