About 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide
5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide (PubChem CID 163231885) has the molecular formula C21H23N5O2
and a molecular weight of 377.45 g/mol. Its IUPAC name is 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide |
| PubChem CID | 163231885 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](N)CN)cc1C(=O)NCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H23N5O2/c1-13-6-8-15(26-21(28)18(23)11-22)10-17(13)20(27)24-12-16-9-7-14-4-2-3-5-19(14)25-16/h2-10,18H,11-12,22-23H2,1H3,(H,24,27)(H,26,28)/t18-/m0/s1 |
| InChIKey | HKPJYTRWMHIFBN-SFHVURJKSA-N |
| XLogP | 1.70 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide?
The IUPAC name of 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide (CID 163231885) is 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide.
What is the SMILES notation for 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide?
The canonical SMILES for 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide is Cc1ccc(NC(=O)[C@@H](N)CN)cc1C(=O)NCc1ccc2ccccc2n1.
What is the InChIKey of 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide?
The InChIKey is HKPJYTRWMHIFBN-SFHVURJKSA-N. The full InChI is InChI=1S/C21H23N5O2/c1-13-6-8-15(26-21(28)18(23)11-22)10-17(13)20(27)24-12-16-9-7-14-4-2-3-5-19(14)25-16/h2-10,18H,11-12,22-23H2,1H3,(H,24,27)(H,26,28)/t18-/m0/s1.
What are the key properties of 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide?
5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide has a molecular weight of 377.45 g/mol, XLogP of 1.70, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2S)-2,3-diaminopropanoyl]amino]-2-methyl-N-(quinolin-2-ylmethyl)benzamide is sourced from PubChem (CID 163231885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).