About (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol
(1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 163231942) has the molecular formula C5H8BrN3O
and a molecular weight of 206.04 g/mol. Its IUPAC name is (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol |
| PubChem CID | 163231942 |
| Molecular Formula | C5H8BrN3O |
| Molecular Weight | 206.04 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol |
| SMILES | C[C@@H](O)c1nc(Br)nn1C |
| InChI | InChI=1S/C5H8BrN3O/c1-3(10)4-7-5(6)8-9(4)2/h3,10H,1-2H3/t3-/m1/s1 |
| InChIKey | DGEBTHFTDOINLS-GSVOUGTGSA-N |
| XLogP | 0.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.04 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol?
The IUPAC name of (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol (CID 163231942) is (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol.
What is the SMILES notation for (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol?
The canonical SMILES for (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol is C[C@@H](O)c1nc(Br)nn1C.
What is the InChIKey of (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol?
The InChIKey is DGEBTHFTDOINLS-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H8BrN3O/c1-3(10)4-7-5(6)8-9(4)2/h3,10H,1-2H3/t3-/m1/s1.
What are the key properties of (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol?
(1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol has a molecular weight of 206.04 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(5-bromo-2-methyl-1,2,4-triazol-3-yl)ethanol is sourced from PubChem (CID 163231942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).