C27H23BrClF2N3O3 — CID 163232518
2-bromo-5-chloro-N-[4-[[3-(2,5-difluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 163232518) has the molecular formula C27H23BrClF2N3O3 and a molecular weight of 590.85 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-[4-[[3-(2,5-difluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 2-bromo-5-chloro-N-[4-[[3-(2,5-difluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163232518 |
| Molecular Formula | C27H23BrClF2N3O3 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | 2-bromo-5-chloro-N-[4-[[3-(2,5-difluorophenyl)-3-hydroxy-2-oxoindol-1-yl]methyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCC(CN2C(=O)C(O)(c3cc(F)ccc3F)c3ccccc32)CC1)c1cc(Cl)cnc1Br |
| InChI | InChI=1S/C27H23BrClF2N3O3/c28-24-19(11-16(29)13-32-24)25(35)33-18-8-5-15(6-9-18)14-34-23-4-2-1-3-20(23)27(37,26(34)36)21-12-17(30)7-10-22(21)31/h1-4,7,10-13,15,18,37H,5-6,8-9,14H2,(H,33,35) |
| InChIKey | GBBBZPPWUUMUEH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|