C22H20ClF2N3O3 — CID 163232574
5-chloro-2-(difluoromethyl)-N-[4-[(2,3-dioxoindol-1-yl)methyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 163232574) has the molecular formula C22H20ClF2N3O3 and a molecular weight of 447.87 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[4-[(2,3-dioxoindol-1-yl)methyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[4-[(2,3-dioxoindol-1-yl)methyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163232574 |
| Molecular Formula | C22H20ClF2N3O3 |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[4-[(2,3-dioxoindol-1-yl)methyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C1C(=O)N(CC2CCC(NC(=O)c3cc(Cl)cnc3C(F)F)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H20ClF2N3O3/c23-13-9-16(18(20(24)25)26-10-13)21(30)27-14-7-5-12(6-8-14)11-28-17-4-2-1-3-15(17)19(29)22(28)31/h1-4,9-10,12,14,20H,5-8,11H2,(H,27,30) |
| InChIKey | UAHZLTANYSOBDY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|