C16H17NO4 — CID 163233058
methyl 3-hydroxy-7-(2-methylpropanoylamino)naphthalene-1-carboxylate (PubChem CID 163233058) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 3-hydroxy-7-(2-methylpropanoylamino)naphthalene-1-carboxylate.
| Compound Name | methyl 3-hydroxy-7-(2-methylpropanoylamino)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 163233058 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 3-hydroxy-7-(2-methylpropanoylamino)naphthalene-1-carboxylate |
| SMILES | COC(=O)c1cc(O)cc2ccc(NC(=O)C(C)C)cc12 |
| InChI | InChI=1S/C16H17NO4/c1-9(2)15(19)17-11-5-4-10-6-12(18)8-14(13(10)7-11)16(20)21-3/h4-9,18H,1-3H3,(H,17,19) |
| InChIKey | OTDLPAAVAOLPHU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |