About 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol
5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol (PubChem CID 163233171) has the molecular formula C10H17FN2O5
and a molecular weight of 264.25 g/mol. Its IUPAC name is 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol.
Molecular Properties
| Compound Name | 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol |
| PubChem CID | 163233171 |
| Molecular Formula | C10H17FN2O5 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol |
| SMILES | CO.Cn1cc(F)c(=O)[nH]c1=O.OC1CCOC1 |
| InChI | InChI=1S/C5H5FN2O2.C4H8O2.CH4O/c1-8-2-3(6)4(9)7-5(8)10;5-4-1-2-6-3-4;1-2/h2H,1H3,(H,7,9,10);4-5H,1-3H2;2H,1H3 |
| InChIKey | POWUPYMHRNCHHU-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol?
The IUPAC name of 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol (CID 163233171) is 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol.
What is the SMILES notation for 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol?
The canonical SMILES for 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol is CO.Cn1cc(F)c(=O)[nH]c1=O.OC1CCOC1.
What is the InChIKey of 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol?
The InChIKey is POWUPYMHRNCHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2O2.C4H8O2.CH4O/c1-8-2-3(6)4(9)7-5(8)10;5-4-1-2-6-3-4;1-2/h2H,1H3,(H,7,9,10);4-5H,1-3H2;2H,1H3.
What are the key properties of 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol?
5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol has a molecular weight of 264.25 g/mol, XLogP of -1.41, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-methylpyrimidine-2,4-dione;methanol;oxolan-3-ol is sourced from PubChem (CID 163233171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).