C27H27F2N3O2 — CID 163233326
3-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4,6-difluoro-5-phenylmethoxy-1H-benzimidazol-2-one (PubChem CID 163233326) has the molecular formula C27H27F2N3O2 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4,6-difluoro-5-phenylmethoxy-1H-benzimidazol-2-one.
| Compound Name | 3-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4,6-difluoro-5-phenylmethoxy-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 163233326 |
| Molecular Formula | C27H27F2N3O2 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4,6-difluoro-5-phenylmethoxy-1H-benzimidazol-2-one |
| SMILES | CC1(C)CCN(c2ccc(-n3c(=O)[nH]c4cc(F)c(OCc5ccccc5)c(F)c43)cc2)CC1 |
| InChI | InChI=1S/C27H27F2N3O2/c1-27(2)12-14-31(15-13-27)19-8-10-20(11-9-19)32-24-22(30-26(32)33)16-21(28)25(23(24)29)34-17-18-6-4-3-5-7-18/h3-11,16H,12-15,17H2,1-2H3,(H,30,33) |
| InChIKey | YPBZVEDFUZPJON-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|