About CID 163233329
CID 163233329 (PubChem CID 163233329) has the molecular formula C7H4BFN2
and a molecular weight of 145.93 g/mol.
Molecular Properties
| Compound Name | CID 163233329 |
| PubChem CID | 163233329 |
| Molecular Formula | C7H4BFN2 |
| Molecular Weight | 145.93 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c2cn[nH]c2c1 |
| InChI | InChI=1S/C7H4BFN2/c8-4-1-6(9)5-3-10-11-7(5)2-4/h1-3H,(H,10,11) |
| InChIKey | SUKACYFDNAKKBQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.93 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163233329 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163233329?
The IUPAC name of CID 163233329 (CID 163233329) is not available.
What is the SMILES notation for CID 163233329?
The canonical SMILES for CID 163233329 is [B]c1cc(F)c2cn[nH]c2c1.
What is the InChIKey of CID 163233329?
The InChIKey is SUKACYFDNAKKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BFN2/c8-4-1-6(9)5-3-10-11-7(5)2-4/h1-3H,(H,10,11).
What are the key properties of CID 163233329?
CID 163233329 has a molecular weight of 145.93 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163233329 is sourced from PubChem (CID 163233329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).