About 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole
1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole (PubChem CID 163233348) has the molecular formula C19H12BrF2N3O
and a molecular weight of 416.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole |
| PubChem CID | 163233348 |
| Molecular Formula | C19H12BrF2N3O |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole |
| SMILES | Fc1cc2nnn(-c3ccc(Br)cc3)c2c(F)c1OCc1ccccc1 |
| InChI | InChI=1S/C19H12BrF2N3O/c20-13-6-8-14(9-7-13)25-18-16(23-24-25)10-15(21)19(17(18)22)26-11-12-4-2-1-3-5-12/h1-10H,11H2 |
| InChIKey | QPLBGIVKTOFZNV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole?
The IUPAC name of 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole (CID 163233348) is 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole.
What is the SMILES notation for 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole?
The canonical SMILES for 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole is Fc1cc2nnn(-c3ccc(Br)cc3)c2c(F)c1OCc1ccccc1.
What is the InChIKey of 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole?
The InChIKey is QPLBGIVKTOFZNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12BrF2N3O/c20-13-6-8-14(9-7-13)25-18-16(23-24-25)10-15(21)19(17(18)22)26-11-12-4-2-1-3-5-12/h1-10H,11H2.
What are the key properties of 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole?
1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole has a molecular weight of 416.23 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-5,7-difluoro-6-phenylmethoxybenzotriazole is sourced from PubChem (CID 163233348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).