C19H19F2N3OS — CID 163233618
1-[4-[(2S,6S)-2,6-dimethylthiomorpholin-4-yl]phenyl]-5,7-difluoroindazol-6-ol (PubChem CID 163233618) has the molecular formula C19H19F2N3OS and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-[4-[(2S,6S)-2,6-dimethylthiomorpholin-4-yl]phenyl]-5,7-difluoroindazol-6-ol.
| Compound Name | 1-[4-[(2S,6S)-2,6-dimethylthiomorpholin-4-yl]phenyl]-5,7-difluoroindazol-6-ol |
|---|---|
| PubChem CID | 163233618 |
| Molecular Formula | C19H19F2N3OS |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-[4-[(2S,6S)-2,6-dimethylthiomorpholin-4-yl]phenyl]-5,7-difluoroindazol-6-ol |
| SMILES | C[C@H]1CN(c2ccc(-n3ncc4cc(F)c(O)c(F)c43)cc2)C[C@H](C)S1 |
| InChI | InChI=1S/C19H19F2N3OS/c1-11-9-23(10-12(2)26-11)14-3-5-15(6-4-14)24-18-13(8-22-24)7-16(20)19(25)17(18)21/h3-8,11-12,25H,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | WJQYXPLUSDVYCV-RYUDHWBXSA-N |
| XLogP | 4.34 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|