About 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol
5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol (PubChem CID 163234042) has the molecular formula C20H22F2N4O3S
and a molecular weight of 436.48 g/mol. Its IUPAC name is 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol.
Molecular Properties
| Compound Name | 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol |
| PubChem CID | 163234042 |
| Molecular Formula | C20H22F2N4O3S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol |
| SMILES | CC1(C)CN(c2ccc3c(cnn3-c3cc(O)c(F)c(F)c3)c2)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C20H22F2N4O3S/c1-20(2)12-24(6-7-25(20)30(3,28)29)14-4-5-17-13(8-14)11-23-26(17)15-9-16(21)19(22)18(27)10-15/h4-5,8-11,27H,6-7,12H2,1-3H3 |
| InChIKey | WIOPBTKZPSYHGB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
The IUPAC name of 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol (CID 163234042) is 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol.
What is the SMILES notation for 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
The canonical SMILES for 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol is CC1(C)CN(c2ccc3c(cnn3-c3cc(O)c(F)c(F)c3)c2)CCN1S(C)(=O)=O.
What is the InChIKey of 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
The InChIKey is WIOPBTKZPSYHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N4O3S/c1-20(2)12-24(6-7-25(20)30(3,28)29)14-4-5-17-13(8-14)11-23-26(17)15-9-16(21)19(22)18(27)10-15/h4-5,8-11,27H,6-7,12H2,1-3H3.
What are the key properties of 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol has a molecular weight of 436.48 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3,3-dimethyl-4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol is sourced from PubChem (CID 163234042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).