About 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol
5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol (PubChem CID 163234057) has the molecular formula C19H11ClF2N2O2
and a molecular weight of 372.76 g/mol. Its IUPAC name is 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol.
Molecular Properties
| Compound Name | 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol |
| PubChem CID | 163234057 |
| Molecular Formula | C19H11ClF2N2O2 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol |
| SMILES | Oc1cc(-n2ncc3cc(-c4ccc(O)c(Cl)c4)ccc32)c(F)cc1F |
| InChI | InChI=1S/C19H11ClF2N2O2/c20-13-6-11(2-4-18(13)25)10-1-3-16-12(5-10)9-23-24(16)17-8-19(26)15(22)7-14(17)21/h1-9,25-26H |
| InChIKey | UDHLPYTWOQRICY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol?
The IUPAC name of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol (CID 163234057) is 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol.
What is the SMILES notation for 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol?
The canonical SMILES for 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol is Oc1cc(-n2ncc3cc(-c4ccc(O)c(Cl)c4)ccc32)c(F)cc1F.
What is the InChIKey of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol?
The InChIKey is UDHLPYTWOQRICY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClF2N2O2/c20-13-6-11(2-4-18(13)25)10-1-3-16-12(5-10)9-23-24(16)17-8-19(26)15(22)7-14(17)21/h1-9,25-26H.
What are the key properties of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol?
5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol has a molecular weight of 372.76 g/mol, XLogP of 5.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,4-difluorophenol is sourced from PubChem (CID 163234057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).