About 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol
5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol (PubChem CID 163234153) has the molecular formula C21H22F2N4O3S
and a molecular weight of 448.50 g/mol. Its IUPAC name is 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol.
Molecular Properties
| Compound Name | 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol |
| PubChem CID | 163234153 |
| Molecular Formula | C21H22F2N4O3S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol |
| SMILES | CS(=O)(=O)N1CCN(c2cc3cnn(-c4cc(O)c(F)c(F)c4)c3cc2C2CC2)CC1 |
| InChI | InChI=1S/C21H22F2N4O3S/c1-31(29,30)26-6-4-25(5-7-26)19-8-14-12-24-27(18(14)11-16(19)13-2-3-13)15-9-17(22)21(23)20(28)10-15/h8-13,28H,2-7H2,1H3 |
| InChIKey | XZGOXWPJCZVCCY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
The IUPAC name of 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol (CID 163234153) is 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol.
What is the SMILES notation for 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
The canonical SMILES for 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol is CS(=O)(=O)N1CCN(c2cc3cnn(-c4cc(O)c(F)c(F)c4)c3cc2C2CC2)CC1.
What is the InChIKey of 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
The InChIKey is XZGOXWPJCZVCCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N4O3S/c1-31(29,30)26-6-4-25(5-7-26)19-8-14-12-24-27(18(14)11-16(19)13-2-3-13)15-9-17(22)21(23)20(28)10-15/h8-13,28H,2-7H2,1H3.
What are the key properties of 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol?
5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol has a molecular weight of 448.50 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-cyclopropyl-5-(4-methylsulfonylpiperazin-1-yl)indazol-1-yl]-2,3-difluorophenol is sourced from PubChem (CID 163234153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).