About 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol
5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol (PubChem CID 163234189) has the molecular formula C19H10ClF3N2O2
and a molecular weight of 390.75 g/mol. Its IUPAC name is 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol.
Molecular Properties
| Compound Name | 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol |
| PubChem CID | 163234189 |
| Molecular Formula | C19H10ClF3N2O2 |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol |
| SMILES | Oc1ccc(-c2ccc3c(cnn3-c3cc(O)c(F)c(F)c3F)c2)cc1Cl |
| InChI | InChI=1S/C19H10ClF3N2O2/c20-12-6-10(2-4-15(12)26)9-1-3-13-11(5-9)8-24-25(13)14-7-16(27)18(22)19(23)17(14)21/h1-8,26-27H |
| InChIKey | ZJASDKRLASUYIK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol?
The IUPAC name of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol (CID 163234189) is 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol.
What is the SMILES notation for 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol?
The canonical SMILES for 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol is Oc1ccc(-c2ccc3c(cnn3-c3cc(O)c(F)c(F)c3F)c2)cc1Cl.
What is the InChIKey of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol?
The InChIKey is ZJASDKRLASUYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10ClF3N2O2/c20-12-6-10(2-4-15(12)26)9-1-3-13-11(5-9)8-24-25(13)14-7-16(27)18(22)19(23)17(14)21/h1-8,26-27H.
What are the key properties of 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol?
5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol has a molecular weight of 390.75 g/mol, XLogP of 5.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3-chloro-4-hydroxyphenyl)indazol-1-yl]-2,3,4-trifluorophenol is sourced from PubChem (CID 163234189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).