About CID 163235314
CID 163235314 (PubChem CID 163235314) has the molecular formula C15H32BN2
and a molecular weight of 251.25 g/mol.
Molecular Properties
| Compound Name | CID 163235314 |
| PubChem CID | 163235314 |
| Molecular Formula | C15H32BN2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.27 |
| IUPAC Name | — |
| SMILES | CC(C)[B]CC(C)(C)CC(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C15H32BN2/c1-13(2)16-12-14(3,4)11-15(5,6)18-9-7-17-8-10-18/h13,17H,7-12H2,1-6H3 |
| InChIKey | SKBULMIXSSCIRJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163235314 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163235314?
The IUPAC name of CID 163235314 (CID 163235314) is not available.
What is the SMILES notation for CID 163235314?
The canonical SMILES for CID 163235314 is CC(C)[B]CC(C)(C)CC(C)(C)N1CCNCC1.
What is the InChIKey of CID 163235314?
The InChIKey is SKBULMIXSSCIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32BN2/c1-13(2)16-12-14(3,4)11-15(5,6)18-9-7-17-8-10-18/h13,17H,7-12H2,1-6H3.
What are the key properties of CID 163235314?
CID 163235314 has a molecular weight of 251.25 g/mol, XLogP of 3.04, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163235314 is sourced from PubChem (CID 163235314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).