C29H27ClF2N6O3 — CID 163236138
6-(2-amino-6-fluorophenyl)-7-chloro-1-[(3-fluoro-1-prop-2-enoylazetidin-3-yl)methyl]-4-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 163236138) has the molecular formula C29H27ClF2N6O3 and a molecular weight of 581.02 g/mol. Its IUPAC name is 6-(2-amino-6-fluorophenyl)-7-chloro-1-[(3-fluoro-1-prop-2-enoylazetidin-3-yl)methyl]-4-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6-(2-amino-6-fluorophenyl)-7-chloro-1-[(3-fluoro-1-prop-2-enoylazetidin-3-yl)methyl]-4-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163236138 |
| Molecular Formula | C29H27ClF2N6O3 |
| Molecular Weight | 581.02 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 6-(2-amino-6-fluorophenyl)-7-chloro-1-[(3-fluoro-1-prop-2-enoylazetidin-3-yl)methyl]-4-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | C=CC(=O)N1CC(F)(Cn2c(=O)c(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4c(N)cccc4F)c(Cl)cc32)C1 |
| InChI | InChI=1S/C29H27ClF2N6O3/c1-5-21(39)36-12-29(32,13-36)14-37-20-11-17(30)24(22-18(31)7-6-8-19(22)33)35-26(20)38(28(41)27(37)40)25-16(4)9-10-34-23(25)15(2)3/h5-11,15H,1,12-14,33H2,2-4H3 |
| InChIKey | IMDPDJAWHWVZIV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.02 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|