C21H19F3N4O2 — CID 163236260
(3S)-3-(oxan-4-yl)-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2,3-dihydrochromen-4-imine (PubChem CID 163236260) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is (3S)-3-(oxan-4-yl)-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2,3-dihydrochromen-4-imine.
| Compound Name | (3S)-3-(oxan-4-yl)-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2,3-dihydrochromen-4-imine |
|---|---|
| PubChem CID | 163236260 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3S)-3-(oxan-4-yl)-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2,3-dihydrochromen-4-imine |
| SMILES | FC(F)(F)c1cc2c(/N=C3\c4ccccc4OC[C@H]3C3CCOCC3)ncnc2[nH]1 |
| InChI | InChI=1S/C21H19F3N4O2/c22-21(23,24)17-9-14-19(27-17)25-11-26-20(14)28-18-13-3-1-2-4-16(13)30-10-15(18)12-5-7-29-8-6-12/h1-4,9,11-12,15H,5-8,10H2,(H,25,26,27)/b28-18+/t15-/m0/s1 |
| InChIKey | GKOBFGSRONTIJN-PZNMAKDTSA-N |
| XLogP | 4.53 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|