C22H23F4N5O2 — CID 163236269
3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;N-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 163236269) has the molecular formula C22H23F4N5O2 and a molecular weight of 465.45 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;N-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;N-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163236269 |
| Molecular Formula | C22H23F4N5O2 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;N-(7-fluoro-3,4-dihydro-2H-chromen-4-yl)-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C1NCC2COCC12.Fc1ccc2c(c1)OCCC2Nc1ncnc2[nH]c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C16H12F4N4O.C6H11NO/c17-8-1-2-9-11(3-4-25-12(9)5-8)23-14-10-6-13(16(18,19)20)24-15(10)22-7-21-14;1-5-3-8-4-6(5)2-7-1/h1-2,5-7,11H,3-4H2,(H2,21,22,23,24);5-7H,1-4H2 |
| InChIKey | HRHUHKKOPWLCPA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |