C27H20N2O7 — CID 163236534
2-[(2S)-azetidine-2-carbonyl]-5-[2-[(2S)-azetidine-2-carbonyl]-1,3-dioxoindene-5-carbonyl]indene-1,3-dione (PubChem CID 163236534) has the molecular formula C27H20N2O7 and a molecular weight of 484.46 g/mol. Its IUPAC name is 2-[(2S)-azetidine-2-carbonyl]-5-[2-[(2S)-azetidine-2-carbonyl]-1,3-dioxoindene-5-carbonyl]indene-1,3-dione.
| Compound Name | 2-[(2S)-azetidine-2-carbonyl]-5-[2-[(2S)-azetidine-2-carbonyl]-1,3-dioxoindene-5-carbonyl]indene-1,3-dione |
|---|---|
| PubChem CID | 163236534 |
| Molecular Formula | C27H20N2O7 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-[(2S)-azetidine-2-carbonyl]-5-[2-[(2S)-azetidine-2-carbonyl]-1,3-dioxoindene-5-carbonyl]indene-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)C(C(=O)[C@@H]1CCN1)C2=O)c1ccc2c(c1)C(=O)C(C(=O)[C@@H]1CCN1)C2=O |
| InChI | InChI=1S/C27H20N2O7/c30-21(11-1-3-13-15(9-11)24(33)19(22(13)31)26(35)17-5-7-28-17)12-2-4-14-16(10-12)25(34)20(23(14)32)27(36)18-6-8-29-18/h1-4,9-10,17-20,28-29H,5-8H2/t17-,18-,19?,20?/m0/s1 |
| InChIKey | DMDGDNWRWMHWML-VCAKUFKGSA-N |
| XLogP | 0.77 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|