C24H14O12S — CID 163236637
3-[5-[2-(2-carboxyacetyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoinden-2-yl]-3-oxopropanoic acid (PubChem CID 163236637) has the molecular formula C24H14O12S and a molecular weight of 526.43 g/mol. Its IUPAC name is 3-[5-[2-(2-carboxyacetyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoinden-2-yl]-3-oxopropanoic acid.
| Compound Name | 3-[5-[2-(2-carboxyacetyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoinden-2-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 163236637 |
| Molecular Formula | C24H14O12S |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | 3-[5-[2-(2-carboxyacetyl)-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoinden-2-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)C1C(=O)c2ccc(S(=O)(=O)c3ccc4c(c3)C(=O)C(C(=O)CC(=O)O)C4=O)cc2C1=O |
| InChI | InChI=1S/C24H14O12S/c25-15(7-17(27)28)19-21(31)11-3-1-9(5-13(11)23(19)33)37(35,36)10-2-4-12-14(6-10)24(34)20(22(12)32)16(26)8-18(29)30/h1-6,19-20H,7-8H2,(H,27,28)(H,29,30) |
| InChIKey | ZIGASAOKLNPAHR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|