C34H24N2O8S — CID 163236762
N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide (PubChem CID 163236762) has the molecular formula C34H24N2O8S and a molecular weight of 620.64 g/mol. Its IUPAC name is N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide.
| Compound Name | N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide |
|---|---|
| PubChem CID | 163236762 |
| Molecular Formula | C34H24N2O8S |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1C(=O)c2ccc(S(=O)(=O)c3ccc4c(c3)C(=O)C(C(=O)Nc3ccccc3C)C4=O)cc2C1=O |
| InChI | InChI=1S/C34H24N2O8S/c1-17-7-3-5-9-25(17)35-33(41)27-29(37)21-13-11-19(15-23(21)31(27)39)45(43,44)20-12-14-22-24(16-20)32(40)28(30(22)38)34(42)36-26-10-6-4-8-18(26)2/h3-16,27-28H,1-2H3,(H,35,41)(H,36,42) |
| InChIKey | BPNQRAGUOOPFNL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|