C35H24N2O7 — CID 163236880
N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide (PubChem CID 163236880) has the molecular formula C35H24N2O7 and a molecular weight of 584.58 g/mol. Its IUPAC name is N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide.
| Compound Name | N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide |
|---|---|
| PubChem CID | 163236880 |
| Molecular Formula | C35H24N2O7 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | N-(2-methylphenyl)-5-[2-[(2-methylphenyl)carbamoyl]-1,3-dioxoindene-5-carbonyl]-1,3-dioxoindene-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1C(=O)c2ccc(C(=O)c3ccc4c(c3)C(=O)C(C(=O)Nc3ccccc3C)C4=O)cc2C1=O |
| InChI | InChI=1S/C35H24N2O7/c1-17-7-3-5-9-25(17)36-34(43)27-30(39)21-13-11-19(15-23(21)32(27)41)29(38)20-12-14-22-24(16-20)33(42)28(31(22)40)35(44)37-26-10-6-4-8-18(26)2/h3-16,27-28H,1-2H3,(H,36,43)(H,37,44) |
| InChIKey | LFUJAKVONJVHDG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|