C13H11F3N2 — CID 163237217
(4E,6E,8E)-5-methyl-7-(trifluoromethyl)-2,12-diazabicyclo[7.3.1]trideca-1(12),2,4,6,8,10-hexaene (PubChem CID 163237217) has the molecular formula C13H11F3N2 and a molecular weight of 252.24 g/mol. Its IUPAC name is (4E,6E,8E)-5-methyl-7-(trifluoromethyl)-2,12-diazabicyclo[7.3.1]trideca-1(12),2,4,6,8,10-hexaene.
| Compound Name | (4E,6E,8E)-5-methyl-7-(trifluoromethyl)-2,12-diazabicyclo[7.3.1]trideca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 163237217 |
| Molecular Formula | C13H11F3N2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (4E,6E,8E)-5-methyl-7-(trifluoromethyl)-2,12-diazabicyclo[7.3.1]trideca-1(12),2,4,6,8,10-hexaene |
| SMILES | CC1=C\C=N/C2=NC=C/C(=C\C(C(F)(F)F)=C/1)C2 |
| InChI | InChI=1S/C13H11F3N2/c1-9-2-4-17-12-8-10(3-5-18-12)7-11(6-9)13(14,15)16/h2-7H,8H2,1H3/b4-2-,9-2+,9-6+,10-7-,11-6+,11-7+,17-4-,17-12+ |
| InChIKey | DGAJXUCSSWEUTA-YHPCRACPSA-N |
| XLogP | 3.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |