C21H14N4 — CID 163237262
3,7-diphenyl-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene (PubChem CID 163237262) has the molecular formula C21H14N4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3,7-diphenyl-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 3,7-diphenyl-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 163237262 |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3,7-diphenyl-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
| SMILES | C1=CC2=NC(c3ccccc3)=NC3=NC(c4ccccc4)=CC(=C1)N23 |
| InChI | InChI=1S/C21H14N4/c1-3-8-15(9-4-1)18-14-17-12-7-13-19-23-20(16-10-5-2-6-11-16)24-21(22-18)25(17)19/h1-14H |
| InChIKey | QIXLCZYSKDLHQW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |