C10H5F3N4 — CID 163237446
12-(trifluoromethyl)-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene (PubChem CID 163237446) has the molecular formula C10H5F3N4 and a molecular weight of 238.17 g/mol. Its IUPAC name is 12-(trifluoromethyl)-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 12-(trifluoromethyl)-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 163237446 |
| Molecular Formula | C10H5F3N4 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 12-(trifluoromethyl)-2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
| SMILES | FC(F)(F)C1=CC=C2C=CN=C3N=CN=C1N23 |
| InChI | InChI=1S/C10H5F3N4/c11-10(12,13)7-2-1-6-3-4-14-9-16-5-15-8(7)17(6)9/h1-5H |
| InChIKey | UHUXSSRSVYABSX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |