C10H9N5 — CID 163237515
2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-12-ylmethanamine (PubChem CID 163237515) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-12-ylmethanamine.
| Compound Name | 2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-12-ylmethanamine |
|---|---|
| PubChem CID | 163237515 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2,4,6,13-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-12-ylmethanamine |
| SMILES | NCC1=C2N=CN=C3N=CC=C(C=C1)N32 |
| InChI | InChI=1S/C10H9N5/c11-5-7-1-2-8-3-4-12-10-14-6-13-9(7)15(8)10/h1-4,6H,5,11H2 |
| InChIKey | RLZBFUCPFWKXCC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |