C22H24F2N4O3 — CID 163237850
N-[6-(cyclopropylmethoxy)pyridazin-3-yl]-2-[(1S,3R)-4,4-difluoro-3-(6-oxo-1H-pyridin-3-yl)cyclohexyl]prop-2-enamide (PubChem CID 163237850) has the molecular formula C22H24F2N4O3 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[6-(cyclopropylmethoxy)pyridazin-3-yl]-2-[(1S,3R)-4,4-difluoro-3-(6-oxo-1H-pyridin-3-yl)cyclohexyl]prop-2-enamide.
| Compound Name | N-[6-(cyclopropylmethoxy)pyridazin-3-yl]-2-[(1S,3R)-4,4-difluoro-3-(6-oxo-1H-pyridin-3-yl)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 163237850 |
| Molecular Formula | C22H24F2N4O3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[6-(cyclopropylmethoxy)pyridazin-3-yl]-2-[(1S,3R)-4,4-difluoro-3-(6-oxo-1H-pyridin-3-yl)cyclohexyl]prop-2-enamide |
| SMILES | C=C(C(=O)Nc1ccc(OCC2CC2)nn1)[C@H]1CCC(F)(F)[C@@H](c2ccc(=O)[nH]c2)C1 |
| InChI | InChI=1S/C22H24F2N4O3/c1-13(21(30)26-18-5-7-20(28-27-18)31-12-14-2-3-14)15-8-9-22(23,24)17(10-15)16-4-6-19(29)25-11-16/h4-7,11,14-15,17H,1-3,8-10,12H2,(H,25,29)(H,26,27,30)/t15-,17+/m0/s1 |
| InChIKey | AALIKDQZOLXOAU-DOTOQJQBSA-N |
| XLogP | 3.67 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|