About 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one
3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one (PubChem CID 163237891) has the molecular formula C9H11F2N3O
and a molecular weight of 215.20 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one |
| PubChem CID | 163237891 |
| Molecular Formula | C9H11F2N3O |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one |
| SMILES | O=c1ccc(C2CNCCC2(F)F)n[nH]1 |
| InChI | InChI=1S/C9H11F2N3O/c10-9(11)3-4-12-5-6(9)7-1-2-8(15)14-13-7/h1-2,6,12H,3-5H2,(H,14,15) |
| InChIKey | PTZUPPGHOXVQBW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one?
The IUPAC name of 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one (CID 163237891) is 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one.
What is the SMILES notation for 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one?
The canonical SMILES for 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one is O=c1ccc(C2CNCCC2(F)F)n[nH]1.
What is the InChIKey of 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one?
The InChIKey is PTZUPPGHOXVQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N3O/c10-9(11)3-4-12-5-6(9)7-1-2-8(15)14-13-7/h1-2,6,12H,3-5H2,(H,14,15).
What are the key properties of 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one?
3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one has a molecular weight of 215.20 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-difluoropiperidin-3-yl)-1H-pyridazin-6-one is sourced from PubChem (CID 163237891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).