C24H34BF2N5O3 — CID 163238022
CID 163238022 (PubChem CID 163238022) has the molecular formula C24H34BF2N5O3 and a molecular weight of 489.38 g/mol.
| Compound Name | CID 163238022 |
|---|---|
| PubChem CID | 163238022 |
| Molecular Formula | C24H34BF2N5O3 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | — |
| SMILES | CC.[B]/C(C=O)=C/C(=C\NC)C1CN(C(C)C(=O)Nc2ccc(OCC3CC3)nn2)CCC1(F)F |
| InChI | InChI=1S/C22H28BF2N5O3.C2H6/c1-14(21(32)27-19-5-6-20(29-28-19)33-13-15-3-4-15)30-8-7-22(24,25)18(11-30)16(10-26-2)9-17(23)12-31;1-2/h5-6,9-10,12,14-15,18,26H,3-4,7-8,11,13H2,1-2H3,(H,27,28,32);1-2H3/b16-10+,17-9+; |
| InChIKey | VAJXYHCGCOBIAI-PMLPMVBZSA-N |
| XLogP | 2.93 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|