C25H30F4N4O5 — CID 163238399
(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 163238399) has the molecular formula C25H30F4N4O5 and a molecular weight of 542.53 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 163238399 |
| Molecular Formula | C25H30F4N4O5 |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(C)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1CC1=NOC2(CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C25H30F4N4O5/c1-13-3-4-15(20(27)19(13)26)16-11-33(32-30-16)21-22(35)18(12-34)37-17(23(21)36-2)9-14-10-24(38-31-14)5-7-25(28,29)8-6-24/h3-4,11,17-18,21-23,34-35H,5-10,12H2,1-2H3/t17-,18-,21+,22+,23+/m1/s1 |
| InChIKey | SRBYGPLICFWXNK-JGOTUQMDSA-N |
| XLogP | 3.32 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |