C24H30F2N4O6 — CID 163238401
(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-2-(hydroxymethyl)-5-methoxyoxan-3-ol (PubChem CID 163238401) has the molecular formula C24H30F2N4O6 and a molecular weight of 508.52 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-2-(hydroxymethyl)-5-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 163238401 |
| Molecular Formula | C24H30F2N4O6 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-6-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-2-(hydroxymethyl)-5-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(C)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1CC1=NOC2(CCOCC2)C1 |
| InChI | InChI=1S/C24H30F2N4O6/c1-13-3-4-15(20(26)19(13)25)16-11-30(29-27-16)21-22(32)18(12-31)35-17(23(21)33-2)9-14-10-24(36-28-14)5-7-34-8-6-24/h3-4,11,17-18,21-23,31-32H,5-10,12H2,1-2H3/t17-,18-,21+,22+,23+/m1/s1 |
| InChIKey | IPSRRNJIPKSWRU-JGOTUQMDSA-N |
| XLogP | 1.92 |
| TPSA | 120.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |