C25H32F2N4O5 — CID 163238417
(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-(1-oxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)oxan-3-ol (PubChem CID 163238417) has the molecular formula C25H32F2N4O5 and a molecular weight of 506.55 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-(1-oxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-(1-oxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)oxan-3-ol |
|---|---|
| PubChem CID | 163238417 |
| Molecular Formula | C25H32F2N4O5 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-(1-oxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)oxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(C)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1CC1=NOC2(CCCCC2)C1 |
| InChI | InChI=1S/C25H32F2N4O5/c1-14-6-7-16(21(27)20(14)26)17-12-31(30-28-17)22-23(33)19(13-32)35-18(24(22)34-2)10-15-11-25(36-29-15)8-4-3-5-9-25/h6-7,12,18-19,22-24,32-33H,3-5,8-11,13H2,1-2H3/t18-,19-,22+,23+,24+/m1/s1 |
| InChIKey | XSCFUEGLPKOXPY-PGEXYDAJSA-N |
| XLogP | 3.08 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |