C24H28F4N4O5 — CID 163238419
(2R,3R,4R,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 163238419) has the molecular formula C24H28F4N4O5 and a molecular weight of 528.50 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 163238419 |
| Molecular Formula | C24H28F4N4O5 |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | (2R,3R,4R,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-[(8,8-difluoro-1-oxa-2-azaspiro[4.5]dec-2-en-3-yl)methyl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | Cc1ccc(-c2cn([C@H]3[C@@H](O)[C@@H](CO)O[C@H](CC4=NOC5(CCC(F)(F)CC5)C4)[C@@H]3O)nn2)c(F)c1F |
| InChI | InChI=1S/C24H28F4N4O5/c1-12-2-3-14(19(26)18(12)25)15-10-32(31-29-15)20-21(34)16(36-17(11-33)22(20)35)8-13-9-23(37-30-13)4-6-24(27,28)7-5-23/h2-3,10,16-17,20-22,33-35H,4-9,11H2,1H3/t16-,17-,20-,21+,22+/m1/s1 |
| InChIKey | ISHQTZLTZLRKTG-SRBMLKMVSA-N |
| XLogP | 2.67 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |