C25H30F2N4O7 — CID 163238438
[(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 163238438) has the molecular formula C25H30F2N4O7 and a molecular weight of 536.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 163238438 |
| Molecular Formula | C25H30F2N4O7 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-[4-(2,3-difluoro-4-methylphenyl)triazol-1-yl]-2-(1,8-dioxa-2-azaspiro[4.5]dec-2-en-3-ylmethyl)-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](n2cc(-c3ccc(C)c(F)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1CC1=NOC2(CCOCC2)C1 |
| InChI | InChI=1S/C25H30F2N4O7/c1-13-3-4-16(21(27)20(13)26)17-11-31(30-28-17)22-23(34)19(12-32)37-18(24(22)36-14(2)33)9-15-10-25(38-29-15)5-7-35-8-6-25/h3-4,11,18-19,22-24,32,34H,5-10,12H2,1-2H3/t18-,19-,22+,23+,24+/m1/s1 |
| InChIKey | HURGGBFMJRZMGJ-PGEXYDAJSA-N |
| XLogP | 1.84 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |