C19H40O4Si — CID 163238483
(E,3S,5R)-5-(methoxymethoxy)-4,4-dimethyl-3-triethylsilyloxynon-7-en-1-ol (PubChem CID 163238483) has the molecular formula C19H40O4Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (E,3S,5R)-5-(methoxymethoxy)-4,4-dimethyl-3-triethylsilyloxynon-7-en-1-ol.
| Compound Name | (E,3S,5R)-5-(methoxymethoxy)-4,4-dimethyl-3-triethylsilyloxynon-7-en-1-ol |
|---|---|
| PubChem CID | 163238483 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (E,3S,5R)-5-(methoxymethoxy)-4,4-dimethyl-3-triethylsilyloxynon-7-en-1-ol |
| SMILES | C/C=C/C[C@@H](OCOC)C(C)(C)[C@H](CCO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H40O4Si/c1-8-12-13-17(22-16-21-7)19(5,6)18(14-15-20)23-24(9-2,10-3)11-4/h8,12,17-18,20H,9-11,13-16H2,1-7H3/b12-8+/t17-,18+/m1/s1 |
| InChIKey | GVVGSDFQVXIBDE-XTUKKMCOSA-N |
| XLogP | 4.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|